mayleth83 mayleth83

23-03-2017
Physics

contestada

What happens when any ray of light strikes a concave mirror, after passing through its focal point?

Respuesta :

Mowen282 Mowen282

23-03-2017

believe that it reflects.

Answer Link

argeliob argeliob

14-04-2021

Answer:

D. The reflected ray travels parallel to the principal axis.

Explanation:

Answer for Plato users.

Answer Link

Otras preguntas

Who formed the first united kingdom of israel?

Blance this out please! Ba(CN)2+2H2SO4=BaSO4+2HCN

find the quotient 9/10 / 5/8 Simplify your answer

mc102-1.jpg Suppose all of the points in the figure are equidistant. Start with your compass point on point A. To create a perpendicular bisector ofmc102-2.jpg

Which chemical reaction would result in the greatest release of energy?

Roll a dice if the dice shows 6 tick the box marked yes. If the dice shows a different number, answer the question. When 360 people are surveyed, 119 tick the y

How does the use of the computer impact businesses

two reasons why many cases of abuse violence are not reported

Fred is trying to earn $35 to buy a basketball. He has saved $11.25. He earns $2.25 per hour doing yard work for his neighbor, and he earns $7.25 per hour selli

_______ are goods purchased from foreign countries