blakehottle2 blakehottle2
  • 23-10-2019
  • History
contestada

The rights and responsibilities of being a citizen in the United States

Respuesta :

001065644 001065644
  • 23-10-2019

Answer:Respect and obey federal, state, and local laws. Respect the rights, beliefs, and opinions of others. Participate in your local community. Pay income and other taxes honestly, and on time, to federal, state, and local authorities.

Explanation:

Answer Link

Otras preguntas

A sample of 9.27 g9.27 g of solid calcium hydroxide is added to 38.5 mL38.5 mL of 0.500 M0.500 M aqueous hydrochloric acid. Write the balanced chemical equation
What is the main idea of this passage?
Classify each of these reactions. Ba(ClO3)2(s)⟶BaCl2(s)+3O2(g)Ba(ClO3)2(s)⟶BaCl2(s)+3O2(g) acid–base neutralization precipitation redox none of the above 2NaCl(
What is the underlying theme of “I, Too, Sing America” by Langston Hughes? A. self-improvement B. criminal guilt C. failed charity D. racial discrimination
Which expression is equivalent to 24^3/4
Describe what historians know about the two sculptures pictured above.
A membrane that allows only some materials to move in and out of the cell is O permeable O semipermeable Origid O bilayered
What is 7-(a-b)-4+(3a-2b)
Help me pleasseeeeeeeeeeeeee
what does it mean if there are two different alleles for a trait